
Catalog Number	AR0039W8
Chemical Name	2(4H)-Benzofuranone,5,6,7,7a-tetrahydro-6-hydroxy-4,4,7a-trimethyl-, (6S,7aR)-
CAS Number	5989-02-6
Molecular Formula	C11H16O3
Molecular Weight	196.2429
MDL Number	MFCD31560831
SMILES	O[C@@H]1C[C@@]2(C)OC(=O)C=C2C(C1)(C)C

2(4H)-Benzofuranone,5,6,7,7a-tetrahydro-6-hydroxy-4,4,7a-trimethyl-, (6S,7aR) is a versatile compound utilized in various chemical synthesis applications. Its unique structure and reactivity make it a valuable building block for the creation of complex organic molecules. In chemical synthesis, this compound can serve as a key intermediate in the production of pharmaceuticals, agrochemicals, and specialty chemicals. Its chiral nature, with the stereochemistry specified by the (6S,7aR) designation, enables precise control over the formation of stereocenters in the final product. By incorporating 2(4H)-Benzofuranone,5,6,7,7a-tetrahydro-6-hydroxy-4,4,7a-trimethyl-, (6S,7aR) into synthetic pathways, chemists can access a wide range of structurally diverse molecules with potential applications in drug discovery, material science, and other fields of research.