
Catalog Number	AR00E9Y2
Chemical Name	(-)-ISOPROTERENOL HYDROCHLORIDE
CAS Number	5984-95-2
Molecular Formula	C11H18ClNO3
Molecular Weight	247.7185
MDL Number	MFCD00064548
SMILES	CC(NC[C@@H](c1ccc(c(c1)O)O)O)C.Cl

The (-)-Isoproterenol hydrochloride is a versatile compound commonly utilized in chemical synthesis as a chiral building block. It serves as a crucial reagent in the preparation of enantiomerically pure compounds due to its unique stereochemistry. Through its application in asymmetric synthesis, this compound enables the creation of complex molecular structures with high optical purity. Researchers often employ (-)-Isoproterenol hydrochloride in the development of pharmaceuticals, agrochemicals, and other fine chemicals, where precise stereochemical control is essential for the activity and safety of the final product. Its ability to efficiently introduce chirality into various molecular frameworks makes it a valuable tool for chemists seeking to produce optically pure substances with defined stereochemical outcomes.