
Catalog Number	AR00E9O1
Chemical Name	apoatropine hydrochloride
CAS Number	5978-81-4
Molecular Formula	C17H22ClNO2
Molecular Weight	307.8151
MDL Number	MFCD10574677
SMILES	CN1C2CCC1CC(C2)OC(=O)C(=C)c1ccccc1.Cl

Benzeneacetic acid, α-methylene-, 8-methyl-8-azabicyclo[3.2.1]oct-3-yl ester, hydrochloride, endo is a valuable compound widely utilized in chemical synthesis for its unique properties and diverse applications. This compound serves as a key intermediate in the synthesis of various pharmaceuticals, particularly those targeting the central nervous system.In chemical synthesis, Benzeneacetic acid, α-methylene-, 8-methyl-8-azabicyclo[3.2.1]oct-3-yl ester, hydrochloride, endo is commonly employed as a building block for the construction of complex organic molecules. Its versatile nature allows chemists to introduce specific functional groups and stereochemistry essential for the desired pharmacological activity of the final products.Furthermore, the endo configuration of this compound plays a crucial role in influencing the reactivity and selectivity of the chemical reactions it participates in. By carefully controlling the endo orientation, chemists can manipulate the course of the synthesis to achieve high yields and purity in the target molecules.Overall, the application of Benzeneacetic acid, α-methylene-, 8-methyl-8-azabicyclo[3.2.1]oct-3-yl ester, hydrochloride, endo in chemical synthesis offers a powerful tool for creating structurally complex and biologically active compounds with potential therapeutic benefits.