
Catalog Number	AR01DY1M
Chemical Name	1-Benzazocine-5-carboxylic acid,8-bromo-1,2,3,4-tetrahydro-1-(2-methylpropyl)-
CAS Number	597583-12-5
Molecular Formula	C16H20BrNO2
Molecular Weight	338.2395
MDL Number	MFCD30530651
SMILES	CC(CN1CCCC(=Cc2c1ccc(c2)Br)C(=O)O)C

The compound (E)-8-Bromo-1-isobutyl-1,2,3,4-tetrahydrobenzo[b]azocine-5-carboxylic acid is utilized in chemical synthesis as a key building block for creating various organic molecules. Its unique structure and reactivity make it a valuable tool in the synthesis of complex compounds with potential pharmaceutical, agricultural, or material science applications. This compound can be used as a precursor in the formation of novel heterocyclic structures, which are important in drug discovery and development. Due to its specific stereochemistry and functional groups, (E)-8-Bromo-1-isobutyl-1,2,3,4-tetrahydrobenzo[b]azocine-5-carboxylic acid serves as a versatile starting material for the creation of diverse organic molecules with tailored properties and functionalities.