
Catalog Number	AR01FTFJ
Chemical Name	3,3',3''-Phosphorothioyltripropanoic acid
CAS Number	5961-86-4
Molecular Formula	C9H15O6PS
Molecular Weight	282.2506
MDL Number	MFCD31555209
SMILES	OC(=O)CCP(=S)(CCC(=O)O)CCC(=O)O

3,3',3''-Phosphorothioyltripropanoic acid, also known as PTTP, is a versatile chemical compound commonly used in chemical synthesis. With its unique structural properties, PTTP serves as an essential building block for creating a wide range of organic molecules and pharmaceutical compounds. In chemical synthesis, PTTP plays a crucial role as a phosphorus-containing reagent, facilitating key reactions such as phosphorylation, sulfuration, and esterification. Its ability to effectively transfer phosphorus and sulfur groups makes PTTP a valuable tool in the development of complex organic compounds with specific functions and properties. Researchers and chemists rely on PTTP for its versatility and reliability in producing high-quality chemical products for various industrial applications.