
Catalog Number	AR00EC6G
Chemical Name	Nikkomycin Z
CAS Number	59456-70-1
Molecular Formula	C20H25N5O10
Molecular Weight	495.44
MDL Number	MFCD00869648
SMILES	OC(=O)[C@H]([C@H]1O[C@H]([C@@H]([C@@H]1O)O)n1ccc(=O)[nH]c1=O)NC(=O)[C@H]([C@@H]([C@@H](c1ccc(cn1)O)O)C)N

Nikkomycin Z is a potent antifungal agent that shows promising applications in chemical synthesis. This compound, derived from Streptomyces tendae, plays a crucial role in the development of novel techniques for the synthesis of chitin, a biopolymer with various industrial applications.In chemical synthesis, Nikkomycin Z is utilized as a chitin synthase inhibitor to selectively target the biosynthesis of chitin in fungi. By inhibiting the enzymatic activity of chitin synthase, Nikkomycin Z disrupts the cell wall formation process in fungal pathogens, leading to their growth inhibition and eventual death. This unique mechanism of action has positioned Nikkomycin Z as a valuable tool in the field of chemical biology and drug discovery.Researchers and chemists leverage the specific inhibitory properties of Nikkomycin Z to gain insights into chitin biosynthesis pathways and develop new strategies for combating fungal infections. Additionally, the use of Nikkomycin Z in chemical synthesis allows for the controlled manipulation of chitin production, paving the way for the design and synthesis of chitin-based materials with diverse applications in biotechnology, nanotechnology, and pharmaceuticals.