
Catalog Number	AR003HXG
Chemical Name	2-Fluoro-1,3-dimethylpyridinium p-toluenesulfonate
CAS Number	59387-91-6
Molecular Formula	C14H16FNO3S
Molecular Weight	297.3451
MDL Number	MFCD00043195
SMILES	Cc1ccc[n+](c1F)C.Cc1ccc(cc1)S(=O)(=O)[O-]

Pyridinium, 2-fluoro-1,3-dimethyl-, 4-methylbenzenesulfonate (1:1) is a versatile reagent commonly used in chemical synthesis for the selective introduction of the 2-fluoro-1,3-dimethylpyridinium moiety. This compound serves as an essential building block in the construction of various pharmaceuticals, agrochemicals, and materials due to its unique electronic and steric properties. In organic synthesis, it acts as a source of the 2-fluoropyridinium group, which can undergo various nucleophilic substitution reactions to introduce the fluorine atom into target molecules. This reagent's utility lies in its ability to facilitate precise and controlled transformations, making it a valuable tool in medicinal chemistry and material science research.