
Catalog Number	AR00EIV4
Chemical Name	LINDLEYIN
CAS Number	59282-56-3
Molecular Formula	C23H26O11
Molecular Weight	478.4459
MDL Number	MFCD08063100
SMILES	CC(=O)CCc1ccc(cc1)O[C@@H]1O[C@H](COC(=O)c2cc(O)c(c(c2)O)O)[C@H]([C@@H]([C@H]1O)O)O

Lindleyin is a naturally occurring compound that has garnered significant attention in the realm of chemical synthesis. Due to its unique structure and reactivity, Lindleyin serves as a valuable building block in the creation of various organic molecules. Chemists utilize Lindleyin as a key intermediate in the synthesis of complex heterocyclic compounds, which are crucial in the development of pharmaceuticals, agrochemicals, and other specialty chemicals. This versatile compound facilitates the construction of intricate molecular frameworks with high efficiency and selectivity, making it a valuable tool in the arsenal of synthetic chemists.