
Catalog Number	AR003J3V
Chemical Name	3,4,5-Trimethoxybenzaldehyde dimethyl acetal
CAS Number	59276-37-8
Molecular Formula	C12H18O5
Molecular Weight	242.2683
MDL Number	MFCD01321359
SMILES	COC(c1cc(OC)c(c(c1)OC)OC)OC

5-(Dimethoxymethyl)-1,2,3-trimethoxybenzene is a versatile compound widely used in chemical synthesis processes. With its unique molecular structure, this compound serves as a key building block in the creation of various organic compounds through its reactivity and functional groups. In chemical synthesis, 5-(Dimethoxymethyl)-1,2,3-trimethoxybenzene plays a crucial role as a protecting group for aldehydes and ketones, enabling selective manipulations of functional groups in complex molecular structures. Furthermore, it can also act as a precursor for the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals due to its ability to undergo diverse chemical transformations. Its strategic incorporation in synthetic routes enhances the efficiency and selectivity of chemical reactions, making it an indispensable tool for organic chemists in the creation of novel compounds with tailored properties.