
Catalog Number	AR00EM9S
Chemical Name	Piperazine, 1-diphenylmethyl-4-methyl-, dihydrochloride
CAS Number	5897-18-7
Molecular Formula	C18H24Cl2N2
Molecular Weight	339.3026
MDL Number	MFCD08437405
SMILES	CN1CCN(CC1)C(c1ccccc1)c1ccccc1.Cl.Cl

1-(Diphenylmethyl)-4-methylpiperazine dihydrochloride is a versatile compound commonly utilized in chemical synthesis for its unique structural properties. In organic chemistry, this compound serves as a valuable building block for the synthesis of various complex molecules. Due to its stable and reactive nature, it is a favored reagent in the preparation of pharmaceuticals, agrochemicals, and specialty chemicals. Additionally, 1-(diphenylmethyl)-4-methylpiperazine dihydrochloride is instrumental in the creation of heterocyclic compounds and substituted piperazines, making it an essential tool for chemists in the field of drug discovery and development. This compound's role in chemical synthesis extends to the formation of novel materials with tailored properties, highlighting its significance in advancing research and innovation.