
Catalog Number	AR00EDTD
Chemical Name	1-(2,4-Dichlorolphenyl)-2-(1H-1,2,4-Triazole-1-Yl)-Ethanone
CAS Number	58905-16-1
Molecular Formula	C10H7Cl2N3O
Molecular Weight	256.08808
MDL Number	MFCD00276315
SMILES	Clc1ccc(c(c1)Cl)C(=O)Cn1cncn1

The compound 1-(2,4-Dichlorophenyl)-2-(1H-1,2,4-triazol-1-yl)ethanone plays a crucial role in chemical synthesis as a versatile intermediate. It is commonly utilized as a key building block in the preparation of various pharmaceuticals, agrochemicals, and other fine chemicals. Its unique structure containing both a phenyl ring and a triazole ring imparts significant reactivity and selectivity in organic transformations.In chemical synthesis, this compound serves as a valuable substrate for the introduction of functional groups via diverse synthetic methodologies such as acylation, alkylation, and cross-coupling reactions. Its triazole ring also exhibits bioactive properties, making it a valuable scaffold for drug discovery and development.Furthermore, the presence of the dichlorophenyl group provides opportunities for selective derivatization, enabling the fine-tuning of physicochemical properties for specific applications. Overall, the strategic placement of functional groups in 1-(2,4-Dichlorophenyl)-2-(1H-1,2,4-triazol-1-yl)ethanone makes it a versatile and indispensable building block in modern synthetic chemistry.