
Catalog Number	AR003D79
Chemical Name	(S)-(5-Oxotetrahydrofuran-2-yl)methyl 4-methylbenzenesulfonate
CAS Number	58879-34-8
Molecular Formula	C12H14O5S
Molecular Weight	270.3016
MDL Number	MFCD00082548
SMILES	O=C1CC[C@H](O1)COS(=O)(=O)c1ccc(cc1)C

The (S)-(5-Oxotetrahydrofuran-2-yl)methyl 4-methylbenzenesulfonate is a highly versatile compound used in chemical synthesis for its ability to act as a chiral building block in the preparation of pharmaceuticals, agrochemicals, and other fine chemicals. When incorporated into organic reactions, it enables the production of enantiomerically pure compounds with high stereoselectivity, making it a valuable tool in asymmetric synthesis. Its unique structure imparts specific reactivity and selectivity, making it an essential component in the creation of complex molecular structures. This compound offers chemists the opportunity to efficiently construct intricate molecules with precise spatial arrangements, opening up new possibilities for drug discovery and development.