
Catalog Number	AR00EKGB
Chemical Name	4(S)-Amino-chroman-3(S)-ol
CAS Number	58810-67-6
Molecular Formula	C9H11NO2
Molecular Weight	165.1891
MDL Number	MFCD18434494
SMILES	O[C@@H]1COc2c([C@@H]1N)cccc2

Cis-4-Aminochroman-3-ol, also known as $name$, is a versatile compound widely used in chemical synthesis for various applications. In organic chemistry, $name$ serves as a valuable building block for the synthesis of complex molecules due to its unique structural features. Its cis conformation and hydroxyl group make it a strategic starting material for the creation of diverse chemical entities through various reactions and transformations.One notable application of $name$ in chemical synthesis is its role as a key intermediate in the production of pharmaceutical compounds. By leveraging the reactivity of the amino and hydroxyl groups present in $name$, chemists can efficiently modify its structure to introduce specific functional groups that are crucial for the desired biological activity of the final drug molecules.Moreover, $name$ can also be utilized in the synthesis of chiral ligands and catalysts, where its stereochemistry plays a critical role in directing the outcome of asymmetric reactions. Through appropriate derivatization and manipulation of the functional groups on the $name$ molecule, chemists can create tailored chiral compounds that exhibit high selectivity and efficiency in catalyzing various chemical transformations.Overall, the use of cis-4-Aminochroman-3-ol in chemical synthesis offers a wide range of opportunities for designing and constructing complex molecules with specific functionalities, making it a valuable tool for synthetic chemists in various research and industrial settings.