
Catalog Number	AR00EFIX
Chemical Name	7-METHYL-1,5-DIOXO-1,2,3,5-TETRAHYDRO-INDOLIZINE-6-CARBONITRILE
CAS Number	58610-63-2
Molecular Formula	C10H8N2O2
Molecular Weight	188.1827
MDL Number	MFCD00192478
SMILES	N#Cc1c(C)cc2n(c1=O)CCC2=O

7-Methyl-1,5-dioxo-1,2,3,5-tetrahydroindolizine-6-carbonitrile, a versatile compound in chemical synthesis, serves as a potent building block for the development of novel pharmaceuticals and organic compounds. Its unique structure and reactivity make it a valuable intermediate in the creation of diverse organic molecules with potential applications in drug discovery and material science. The carbonitrile group in 7-Methyl-1,5-dioxo-1,2,3,5-tetrahydroindolizine-6-carbonitrile enables facile transformation into various functional groups, allowing for the synthesis of complex molecules with tailored properties. In medicinal chemistry, this compound can be utilized for the synthesis of new heterocyclic compounds with potential biological activities, thus contributing to the advancement of drug development efforts. Its role in chemical synthesis extends beyond pharmaceuticals, offering a wide range of possibilities in the creation of specialty chemicals and functional materials with unique properties and applications.