
Catalog Number	AR00IL9B
Chemical Name	Benzene, 1-bromo-4-[(1E)-2-(4-methylphenyl)ethenyl]-
CAS Number	58358-52-4
Molecular Formula	C15H13Br
Molecular Weight	273.16772000000003
MDL Number	MFCD11502689
SMILES	Cc1ccc(cc1)/C=C/c1ccc(cc1)Br

The (E)-1-Bromo-4-(4-methylstyryl)benzene is a valuable chemical compound that finds important applications in organic synthesis. This compound serves as a key building block in the synthesis of various aromatic organic molecules. Its unique structure and reactivity make it a versatile reagent for the construction of complex organic molecules in the laboratory.In chemical synthesis, (E)-1-Bromo-4-(4-methylstyryl)benzene can be utilized as a precursor in the preparation of biologically active compounds, pharmaceutical intermediates, and functional materials. Its bromine functionality allows for further functionalization reactions, such as Suzuki cross-coupling, Heck coupling, and palladium-catalyzed C-C bond formation reactions. The presence of the styryl group provides opportunities for introducing aromatic substitutions and modifications to tailor the properties of the target molecules.Overall, (E)-1-Bromo-4-(4-methylstyryl)benzene plays a crucial role in the organic synthesis toolbox, enabling chemists to access novel compounds with diverse chemical properties and potential applications.