
Catalog Number	AR01I9QJ
Chemical Name	4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-7-hydroxy-5-methoxy-
CAS Number	58115-29-0
Molecular Formula	C16H12O6
Molecular Weight	300.2629
MDL Number	MFCD18451060
SMILES	COc1cc(O)cc2c1c(=O)cc(o2)c1ccc(c(c1)O)O

4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-7-hydroxy-5-methoxy- is a valuable compound used in chemical synthesis for its versatile applications. This compound plays a crucial role in synthetic organic chemistry as a key building block for the creation of various pharmaceuticals, natural products, and research chemicals. Its unique structure and functional groups make it an essential component in the development of advanced drug molecules and complex organic compounds. This compound is particularly sought after in drug discovery and medicinal chemistry for its potential therapeutic properties and pharmacological activities. Its incorporation in chemical synthesis processes allows for the efficient production of novel molecules with diverse biological functions and applications in different fields of science and technology.