
Catalog Number	AR00EHB8
Chemical Name	averantin
CAS Number	5803-62-3
Molecular Formula	C20H20O7
Molecular Weight	372.3686
MDL Number	MFCD01664488
SMILES	CCCCCC(c1c(O)cc2c(c1O)C(=O)c1c(C2=O)cc(cc1O)O)O

The application of (-)-Averantin in chemical synthesis is highly significant due to its versatile properties and reactivity. This compound serves as a valuable chiral building block in the synthesis of various pharmaceuticals, natural products, and fine chemicals. Its asymmetric nature allows for the creation of enantiopure molecules, which are crucial in drug discovery and development.(-)-Averantin can be employed in the asymmetric synthesis of complex molecules, enabling chemists to access specific stereoisomers with high selectivity. This compound's unique structure and reactivity make it a valuable tool in the construction of challenging molecular frameworks. In addition, (-)-Averantin can participate in a variety of key synthetic transformations, such as asymmetric additions, cycloadditions, and rearrangements, making it a versatile reagent in organic chemistry.Overall, the use of (-)-Averantin in chemical synthesis allows for the efficient and selective formation of complex molecules with high stereoselectivity, making it an indispensable tool for synthetic chemists in various research and industrial applications.