
Catalog Number	AR01EAV5
Chemical Name	(Val5)-Angiotensin II H-Asp-Arg-Val-Tyr-Val-His-Pro-Phe-OH
CAS Number	58-49-1
Molecular Formula	C49H69N13O12
Molecular Weight	1032.1521
MDL Number	MFCD00167495
SMILES	NC(=N)NCCC[C@@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N1CCC[C@H]1C(=O)N[C@H](C(=O)O)Cc1ccccc1)Cc1nc[nH]c1)C(C)C)Cc1ccc(cc1)O)C(C)C)NC(=O)[C@H](CC(=O)O)N

Angiotensin II 5-Valine is a key component used in chemical synthesis for its role in peptide formation and bioactive peptide research. As a modified form of Angiotensin II, the incorporation of Valine at the fifth position adds unique chemical properties that enhance the peptide's stability and bioactivity. This specific modification plays a crucial role in the design and development of peptide-based pharmaceuticals, offering improved pharmacokinetic profiles and biological functions. In chemical synthesis, Angiotensin II 5-Valine serves as a versatile building block for creating novel peptide structures and exploring their potential therapeutic applications in areas such as cardiovascular diseases and hypertension. Its strategic placement within peptide sequences can influence interactions with target receptors and aid in the modulation of physiological processes, making it a valuable tool for researchers and drug developers alike.