
Catalog Number	AR00F1Z6
Chemical Name	triphenylsulphonium hexafluoroantimonate(1-)
CAS Number	57840-38-7
Molecular Formula	C18H15F6SSb
Molecular Weight	499.1271
SMILES	c1ccc(cc1)[S+](c1ccccc1)c1ccccc1.F[Sb-](F)(F)(F)(F)F

Triphenylsulfonium hexafluoroantimonate is a versatile compound that finds valuable applications in organic synthesis. As a strong oxidizing agent, it is commonly used in the oxidation of various organic compounds, such as alcohols, sulfides, and amines, to yield the corresponding functionalized products. Additionally, Triphenylsulfonium hexafluoroantimonate serves as a useful reagent in the construction of carbon-carbon and carbon-heteroatom bonds through diverse transformation reactions. Its high reactivity and selectivity make it a valuable tool for chemists working in the field of organic synthesis, enabling efficient and controlled transformations of complex molecules.