
Catalog Number	AR00ED9M
Chemical Name	Triphenylsulfonium Hexafluorophosphate
CAS Number	57835-99-1
Molecular Formula	C18H15F6PS
Molecular Weight	408.3409
MDL Number	MFCD00083120
SMILES	c1ccc(cc1)[S+](c1ccccc1)c1ccccc1.[F-][P+5]([F-])([F-])([F-])([F-])[F-]

Triphenylsulfonium hexafluorophosphate is a versatile reagent commonly used in chemical synthesis for its ability to act as a powerful source of the trifluoromethyl radical. This reagent is especially valuable in the introduction of trifluoromethyl groups into organic molecules, a functional group that has gained significant interest in medicinal chemistry due to its unique properties. By serving as a convenient and efficient source of trifluoromethyl radicals, Triphenylsulfonium hexafluorophosphate enables chemists to access a wide range of fluorinated compounds that exhibit enhanced biological activities. Additionally, this reagent offers excellent functional group compatibility and can be employed in various synthetic transformations, making it a valuable tool for the synthesis of complex organic molecules.