
Catalog Number	AR01CCIM
Chemical Name	Adenosine, N-methyl-2'-O-methyl-
CAS Number	57817-83-1
Molecular Formula	C12H17N5O4
Molecular Weight	295.2945
MDL Number	MFCD27952524
SMILES	CO[C@@H]1[C@H](O)[C@H](O[C@H]1n1cnc2c1ncnc2NC)CO

N6-Methyl-2'-O-methyladenosine is a versatile compound widely used in chemical synthesis. This modification plays a crucial role in the development of novel pharmaceuticals, especially in the field of antiviral and anticancer drug discovery. As a key building block in organic chemistry, N6-Methyl-2'-O-methyladenosine is essential for the synthesis of advanced molecular structures with desired properties. Its unique reactivity and compatibility with various reaction conditions make it a valuable tool for creating complex molecules with enhanced biological activities. In particular, the incorporation of N6-Methyl-2'-O-methyladenosine into nucleic acids and pharmaceutical intermediates enables the design of tailored compounds for targeted therapeutic applications. Moreover, its stability and solubility facilitate the efficient production of high-quality chemical entities for further study and development. With its strategic role in chemical synthesis, N6-Methyl-2'-O-methyladenosine continues to drive innovation and progress in the pharmaceutical industry, offering new opportunities for drug design and discovery.