
Catalog Number	AR00EMPH
Chemical Name	LEDOL
CAS Number	577-27-5
Molecular Formula	C15H26O
Molecular Weight	222.3663
MDL Number	MFCD01632472
SMILES	C[C@@H]1CC[C@H]2[C@@H]1[C@H]1[C@H](C1(C)C)CC[C@@]2(C)O

(+)-Ledol is a chiral compound that holds significant importance in various chemical synthesis applications. Its stereoselective properties make it a valuable building block for the creation of complex molecules and pharmaceuticals. In organic synthesis, (+)-Ledol can be utilized as a key intermediate for generating diverse compounds with specific chirality, enhancing the efficiency and precision of reactions. Its unique structure offers versatility in creating enantiomerically pure compounds, making it a crucial tool in asymmetric synthesis strategies. Additionally, (+)-Ledol's distinctive characteristics contribute to the development of innovative synthetic routes, enabling chemists to access a wide range of structurally diverse molecules for pharmaceutical, agrochemical, and material science applications.