
Catalog Number	AR01CC60
Chemical Name	1-Naphthacenecarboxylic acid,2-ethyl-1,2,3,4,6,11-hexahydro-2,5,7-trihydroxy-6,11-dioxo-4-[[2,3,6-trideoxy-4-O-[2,6-dideoxy-4-O-[(2R-trans)-tetrahydro-6-methyl-5-oxo-2H-pyran-2-yl]-a-L-lyxo-hexopyranosyl]-3-(dimethylamino)-a-L-lyxo-hexopyranosyl]oxy]-, methyl ester, [1R-(1a,2b,4b)]-
CAS Number	57576-44-0
Molecular Formula	C42H53NO15
Molecular Weight	811.8679
MDL Number	MFCD00866250
SMILES	COC(=O)[C@@H]1c2cc3c(c(c2[C@H](C[C@]1(O)CC)O[C@@H]1O[C@@H](C)[C@H]([C@H](C1)N(C)C)O[C@H]1C[C@H](O)[C@@H]([C@@H](O1)C)O[C@H]1CCC(=O)[C@@H](O1)C)O)C(=O)c1c(C3=O)cccc1O

Aclarubicin is a potent anthracycline antibiotic often used in chemical synthesis for its exceptional ability to intercalate and bind to DNA. This property allows Aclarubicin to effectively inhibit topoisomerase II activity, a crucial enzyme in DNA replication and repair processes. As a result, Aclarubicin is frequently employed in the laboratory for its role in studying DNA interactions and biological processes at the molecular level. Its unique chemical structure and mechanism of action make Aclarubicin a valuable tool in drug development and research for understanding the intricate complexities of DNA manipulation and gene regulation.