
Catalog Number	AR01X021
Chemical Name	Methyl 5-amino-2-(trifluoromethyl)benzoate
CAS Number	575474-23-6
Molecular Formula	C9H8F3NO2
Molecular Weight	219.1605
MDL Number	MFCD28727592
SMILES	COC(=O)c1cc(N)ccc1C(F)(F)F

\nMethyl 5-amino-2-(trifluoromethyl)benzoate, as a critical building block in chemical synthesis, plays a significant role in the development of various pharmaceuticals, agrochemicals, and materials. Its versatile structure allows for diverse synthetic pathways and functional group interconversions, making it a valuable tool for chemists in creating novel compounds and materials. In chemical synthesis, Methyl 5-amino-2-(trifluoromethyl)benzoate serves as a key intermediate in the preparation of pharmaceutical agents, herbicides, and insecticides. Its unique structural features, notably the trifluoromethyl group and amino functionality, enable chemists to introduce specific properties into target molecules, enhancing their biological activity or chemical reactivity. Additionally, Methyl 5-amino-2-(trifluoromethyl)benzoate can participate in various coupling reactions, such as amide formation and Suzuki-Miyaura cross-coupling, expanding its utility in the synthesis of complex organic compounds. By incorporating this compound strategically into synthetic routes, chemists can streamline processes, optimize yields, and access new chemical space for drug discovery and material design.