
Catalog Number	AR00EC7C
Chemical Name	Ketoprofen lysinate
CAS Number	57469-78-0
Molecular Formula	C22H28N2O5
Molecular Weight	400.4681
MDL Number	MFCD03701078
SMILES	CC(c1cccc(c1)C(=O)c1ccccc1)C(=O)O.NCCCC[C@@H](C(=O)O)N

Ketoprofen Lysinate is a potent pharmaceutical intermediate widely used in chemical synthesis processes. Its application in organic synthesis is particularly valuable due to its ability to serve as a crucial building block in the production of various pharmaceutical compounds. Ketoprofen Lysinate plays a key role in the formation of diverse chemical structures, making it an essential component in the creation of many important drugs. Its unique chemical properties enable efficient and precise reactions, leading to the synthesis of high-quality pharmaceutical products. In the realm of chemical synthesis, Ketoprofen Lysinate serves as a versatile and indispensable tool for chemists and researchers alike.