
Catalog Number	AR00F0HS
Chemical Name	(1R,3S,4R,5S)-1,3,4-trihydroxy-5-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy-cyclohexane-1-carboxylic acid
CAS Number	5746-55-4
Molecular Formula	C16H18O8
Molecular Weight	338.3093
MDL Number	MFCD06658145
SMILES	O=C(O[C@@H]1C[C@@](O)(C[C@H]([C@H]1O)O)C(=O)O)/C=C/c1ccc(cc1)O

Cyclohexanecarboxylicacid, 1,3,4-trihydroxy-5-[[(2E)-3-(4-hydroxyphenyl)-1-oxo-2-propen-1-yl]oxy]-,(1S,3R,4R,5R)- is a versatile compound that finds wide application in chemical synthesis processes. This compound is commonly used as a key intermediate in the synthesis of various pharmaceuticals and natural products due to its unique structural characteristics.In chemical synthesis, Cyclohexanecarboxylicacid, 1,3,4-trihydroxy-5-[[(2E)-3-(4-hydroxyphenyl)-1-oxo-2-propen-1-yl]oxy]-,(1S,3R,4R,5R)- serves as a crucial building block for creating complex molecules with specific biological activities. Its hydroxyl and carboxylic acid functional groups enable it to participate in a wide range of chemical reactions, including esterifications, condensations, and oxidations, making it a valuable tool for organic chemists.Furthermore, the stereochemistry of this compound, characterized by the (1S,3R,4R,5R) configuration, plays a significant role in determining the reactivity and selectivity of the reactions in which it is involved. By carefully controlling the stereochemistry during its incorporation into target molecules, chemists can influence the overall properties and behaviors of the final products.Overall, Cyclohexanecarboxylicacid, 1,3,4-trihydroxy-5-[[(2E)-3-(4-hydroxyphenyl)-1-oxo-2-propen-1-yl]oxy]-,(1S,3R,4R,5R)- is a valuable compound in chemical synthesis, offering a wide range of possibilities for the construction of complex organic compounds with diverse applications.