
Catalog Number	AR01DP13
Chemical Name	Calcium ascorbate
CAS Number	5743-27-1
Molecular Formula	C12H14CaO12
Molecular Weight	390.3104
MDL Number	MFCD00082341
SMILES	OC[C@@H]([C@H]1OC(=O)C(=C1[O-])O)O.OC[C@@H]([C@H]1OC(=O)C(=C1[O-])O)O.[Ca+2]

Utilizing calcium ascorbate in chemical synthesis has proven to be an invaluable tool for various applications. As a form of vitamin C, calcium ascorbate acts as a powerful reducing agent, facilitating a wide range of oxidation-reduction reactions. Its ability to donate electrons makes it an effective catalyst in organic transformations and synthesis processes. The inclusion of calcium in the compound enhances its stability and solubility, presenting a more versatile and efficient ingredient for chemical reactions. In addition, the presence of calcium also offers the benefit of promoting bone health and supporting overall well-being, making calcium ascorbate a multifunctional component in chemical synthesis.