
Catalog Number	AR00EC2O
Chemical Name	TRANS-2-AMINO-CYCLOHEXANECARBOXYLIC ACID HYDROCHLORIDE
CAS Number	57266-57-6
MDL Number	MFCD05863557
SMILES	N[C@@H]1CCCC[C@H]1C(=O)O.Cl \|&1:2,7,r\|

Trans-2-amino-cyclohexanecarboxylic acid hydrochloride is a versatile chemical compound widely used in chemical synthesis processes. Its unique structure and properties make it a valuable building block in the creation of various pharmaceuticals, agrochemicals, and specialty chemicals. This compound plays a crucial role in the synthesis of complex molecules by serving as a key intermediate or precursor in organic reactions. With its ability to undergo various transformations and functionalizations, Trans-2-amino-cyclohexanecarboxylic acid hydrochloride enables chemists to introduce specific functionalities and stereochemistries into target molecules efficiently. Its application in chemical synthesis provides a powerful tool for the design and production of advanced materials and biologically active compounds.