
Catalog Number	AR003NHL
Chemical Name	5-HYDROXYDOPAMINE HYDROCHLORIDE
CAS Number	5720-26-3
Molecular Formula	C8H12ClNO3
Molecular Weight	205.6388
MDL Number	MFCD00012899
SMILES	[NH3+]CCc1cc(O)c(c(c1)O)O.[Cl-]

2-(3,4,5-Trihydroxyphenyl)ethylamine hydrochloride is a versatile compound commonly utilized in chemical synthesis processes. This compound plays a crucial role in the field of organic chemistry due to its ability to serve as a key building block for the synthesis of various important molecules.In chemical synthesis, 2-(3,4,5-Trihydroxyphenyl)ethylamine hydrochloride is frequently employed as a starting material for the preparation of diverse pharmaceuticals, agrochemicals, and fine chemicals. Its unique structure enables the incorporation of the trihydroxyphenyl moiety into target molecules, adding specific chemical functionalities and properties.Moreover, the presence of the ethylamine group in the compound facilitates further functionalization through various chemical reactions, allowing for the introduction of different substituents or modifications to tailor the properties of the final product. This flexibility makes 2-(3,4,5-Trihydroxyphenyl)ethylamine hydrochloride a valuable tool in the synthesis of complex organic molecules with specific desired characteristics.Overall, the application of 2-(3,4,5-Trihydroxyphenyl)ethylamine hydrochloride in chemical synthesis offers a wide range of possibilities for designing and accessing novel compounds with potential applications in pharmaceuticals, materials science, and other fields of research.