
Catalog Number	AR01GJ5M
Chemical Name	1,2-BENZENEDIOL, 4-ETHENYL-, DIACETATE
CAS Number	57142-64-0
Molecular Formula	C12H12O4
Molecular Weight	220.2213
MDL Number	MFCD12912609
SMILES	C=Cc1ccc(c(c1)OC(=O)C)OC(=O)C

4-Vinyl-1,2-phenylene diacetate, also known as $name$, is a versatile compound used in various chemical synthesis applications. This compound serves as a valuable building block in the creation of polymers, resins, and specialty chemicals due to its unique chemical properties. When utilized in chemical reactions, 4-Vinyl-1,2-phenylene diacetate can undergo polymerization processes to form high-performance materials with tailored properties and functionalities. Additionally, this compound can be employed as a key intermediate in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals, contributing to the development of innovative products in the chemical industry. Its ability to participate in diverse chemical transformations makes it a valuable tool for organic chemists and researchers seeking to design and synthesize novel compounds for various applications.