
Catalog Number	AR00EMEB
Chemical Name	N-[2-(1H-Indol-3-yl)acetyl]-L-glutamic acid
CAS Number	57105-48-3
Molecular Formula	C15H16N2O5
Molecular Weight	304.29794
MDL Number	MFCD16036311
SMILES	O=C(Cc1c[nH]c2c1cccc2)N[C@H](C(=O)O)CCC(=O)O

Indole-3-acetyl glutamate is a versatile compound that finds a wide range of applications in chemical synthesis. One of the key roles of Indole-3-acetyl glutamate in chemical synthesis is as a precursor in the production of indole-based derivatives. Indole derivatives are essential building blocks in the synthesis of various pharmaceuticals, agrochemicals, and natural products. Indole-3-acetyl glutamate serves as a valuable starting material for the synthesis of diverse compounds due to its unique structure and reactivity.Additionally, Indole-3-acetyl glutamate can also be employed as a key intermediate in the synthesis of indole alkaloids, which possess significant biological activities. By utilizing Indole-3-acetyl glutamate as a starting point, chemists can access a wide variety of indole alkaloids through strategic transformations and functional group manipulations.In summary, the application of Indole-3-acetyl glutamate in chemical synthesis is instrumental in the efficient preparation of indole-based compounds and indole alkaloids, contributing to the development of new drug candidates, agrochemicals, and bioactive molecules.