
Catalog Number	AR003T03
Chemical Name	N-(3-Indolylacetyl)-L-Isoleucine
CAS Number	57105-45-0
Molecular Formula	C16H20N2O3
Molecular Weight	288.3416
MDL Number	MFCD00075401
SMILES	CC[C@@H]([C@@H](C(=O)O)NC(=O)Cc1c[nH]c2c1cccc2)C

N-(3-Indolylacetyl)-L-isoleucine, commonly known as $name$, is a versatile compound widely used in chemical synthesis due to its unique properties. This compound serves as a key intermediate in the production of pharmaceuticals, agrochemicals, and specialty chemicals. $name$ plays a crucial role in the synthesis of diverse organic compounds, particularly in the construction of complex molecular structures. Its specific structure allows for selective functional group transformations, enabling chemists to achieve precise control over the synthesis of target molecules. In chemical synthesis, $name$ acts as a valuable building block for the creation of novel compounds with potential applications in various industries.