
Catalog Number	AR01ILB2
Chemical Name	8,13-DIHYDROINDOLO[2',3':3,4]PYRIDO[1,2-B][2,7]NAPHTHYRIDIN-5(7H)-ONE
CAS Number	57103-51-2
Molecular Formula	C18H13N3O
Molecular Weight	287.3153
SMILES	O=c1c2cnccc2cc2-c3c(CCn12)c1c([nH]3)cccc1

The compound $name$ is widely utilized in chemical synthesis as a versatile building block due to its unique structural properties. Specifically, in synthetic chemistry, 8,13-DIHYDROINDOLO[2',3':3,4]PYRIDO[1,2-B][2,7]NAPHTHYRIDIN-5(7H)-ONE serves as a key intermediate in the production of various pharmaceuticals, agrochemicals, and materials. Its distinct molecular structure enables it to participate in a range of chemical reactions, allowing for the efficient construction of valuable organic compounds. In particular, its presence in synthetic pathways facilitates the formation of complex heterocyclic structures, making it a valuable tool for chemists seeking to create novel molecules with diverse functionalities.