
Catalog Number	AR00EKW0
Chemical Name	3,5,7-Trihydroxy-2-(4-hydroxyphenyl)-8-methoxy-4H-1-benzopyran-4-one
CAS Number	571-74-4
Molecular Formula	C16H12O7
Molecular Weight	316.2623
SMILES	COc1c(O)cc(c2c1oc(c1ccc(cc1)O)c(c2=O)O)O

8-Methoxykaempferol, a natural flavonoid compound, serves as a valuable building block in chemical synthesis due to its unique structure and versatile reactivity. In organic chemistry, 8-Methoxykaempferol can be utilized as a key intermediate in the synthesis of various pharmaceuticals, agrochemicals, and other bioactive compounds. Its methoxy group enhances its chemical properties, making it a suitable candidate for introducing specific functional groups during synthesis. Additionally, the presence of a kaempferol scaffold provides additional opportunities for diversification through modifications at different positions, allowing for the creation of novel molecules with potentially enhanced properties. With its potential applications in medicinal chemistry, materials science, and other fields, 8-Methoxykaempferol plays a crucial role as a versatile and valuable compound in chemical synthesis.