
Catalog Number	AR00F17E
Chemical Name	4-OXO-4-(3-TRIFLUOROMETHYLPHENYL)BUTYRIC ACID
CAS Number	56948-76-6
Molecular Formula	C11H9F3O3
Molecular Weight	246.1826
MDL Number	MFCD02260916
SMILES	OC(=O)CCC(=O)c1cccc(c1)C(F)(F)F

4-OXO-4-(3-TRIFLUOROMETHYLPHENYL)BUTYRIC ACID is a versatile compound employed in numerous chemical synthesis processes. It often serves as a key intermediate in the production of pharmaceuticals, agrochemicals, and specialty chemicals. In chemical synthesis, this compound acts as a crucial building block, facilitating the creation of complex molecular structures with specific functionalities. Its unique structure, characterized by the presence of a trifluoromethyl group and a butyric acid backbone, imparts desirable properties to the final products. Through strategic manipulation and derivatization, chemists can harness the reactivity and selectivity of 4-OXO-4-(3-TRIFLUOROMETHYLPHENYL)BUTYRIC ACID to achieve targeted modifications and generate diverse chemical entities. This compound's utility lies in its ability to participate in a variety of transformations, enabling the synthesis of valuable compounds with applications across various industries.