
Catalog Number	AR00E9G2
Chemical Name	Chlorotrianisene
CAS Number	569-57-3
Molecular Formula	C23H21ClO3
Molecular Weight	380.864
MDL Number	MFCD00048044
SMILES	COc1ccc(cc1)C(=C(c1ccc(cc1)OC)Cl)c1ccc(cc1)OC

Chlorotrianisene, commonly known as TACE, is a potent chemical compound that finds crucial applications in chemical synthesis processes. This synthetic compound is widely utilized as a selective estrogen receptor modulator, making it valuable for studies focused on hormone activity and related mechanisms. In chemical synthesis, Chlorotrianisene serves as a key reagent in the development of various pharmaceuticals and organic compounds due to its ability to interact with estrogen receptors in a controlled manner. Its unique properties make it a versatile tool for researchers and chemists seeking to understand and manipulate hormonal pathways in their experiments.