
Catalog Number	AR00EFJY
Chemical Name	alpha-Peltatin
CAS Number	568-53-6
Molecular Formula	C21H20O8
Molecular Weight	400.3787
MDL Number	MFCD00873738
SMILES	COc1cc(cc(c1O)OC)[C@H]1[C@H]2C(=O)OC[C@@H]2Cc2c1cc1OCOc1c2O

α-Peltatin is a natural compound that serves as a potent building block in chemical synthesis processes. Its unique molecular structure and reactivity make it a valuable tool in organic chemistry, particularly in the development of pharmaceuticals and other fine chemicals.When used in chemical synthesis, α-Peltatin can undergo various transformations, such as selective functional group modifications and structural manipulations, to produce a wide range of derivatives with different biological activities and properties. This versatility allows researchers to tailor the molecular structure of α-Peltatin derivatives to optimize their performance in specific applications.In pharmaceutical research, α-Peltatin derivatives have shown promising anticancer, antiviral, and antibacterial activities, making them potential candidates for the development of new therapeutic agents. Additionally, the ability to incorporate α-Peltatin into complex molecular frameworks enables the synthesis of structurally diverse compounds that can be screened for bioactivity against various disease targets.Overall, the application of α-Peltatin in chemical synthesis offers a powerful platform for the creation of novel molecules with potential pharmacological significance and opens up new opportunities for drug discovery and development.