
Catalog Number	AR01CD7B
Chemical Name	5-Thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid,7-[[[(cyanomethyl)thio]acetyl]amino]-7-methoxy-3-[[(1-methyl-1H-tetrazol-5-yl)thio]methyl]-8-oxo-, (6R,7S)-
CAS Number	56796-20-4
Molecular Formula	C15H17N7O5S3
Molecular Weight	471.53437999999994
MDL Number	MFCD00865068
SMILES	N#CCSCC(=O)N[C@]1(OC)C(=O)N2[C@@H]1SCC(=C2C(=O)O)CSc1nnnn1C

Cefmetazole, a semi-synthetic cephalosporin antibiotic, is widely utilized in chemical synthesis as a powerful tool for the functionalization of various organic compounds. Its unique structural properties make it a valuable reagent in the formation of new carbon-carbon and carbon-heteroatom bonds, crucial for the synthesis of complex molecules in medicinal chemistry. By harnessing the reactivity of Cefmetazole, chemists can efficiently introduce diverse functional groups and stereochemical elements into organic frameworks, enabling the development of novel pharmaceuticals, agrochemicals, and materials with tailored properties and enhanced biological activities.