
Catalog Number	AR003CLL
Chemical Name	Pent-4-en-1-yltriphenylphosphonium bromide
CAS Number	56771-29-0
Molecular Formula	C23H24BrP
Molecular Weight	411.3144
MDL Number	MFCD00050215
SMILES	C=CCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-]

Pent-4-en-1-yltriphenylphosphonium bromide is a highly versatile compound commonly used in organic synthesis due to its unique reactivity and stability. This compound serves as a valuable reagent in various reactions, particularly in the synthesis of complex organic molecules. Its pent-4-en-1-yl group provides a reactive site for nucleophilic addition reactions, making it a useful tool for constructing carbon-carbon bonds.One of the key applications of Pent-4-en-1-yltriphenylphosphonium bromide is in the Wittig reaction, where it acts as a precursor to generate alkene derivatives. By reacting with carbonyl compounds such as aldehydes or ketones, this compound facilitates the formation of olefins through the generation of ylides. This synthetic route allows for the selective introduction of alkene functionalities into target molecules, enabling the construction of diverse organic frameworks.Furthermore, Pent-4-en-1-yltriphenylphosphonium bromide is also employed in cross-coupling reactions, where it serves as a source of the nucleophilic pent-4-en-1-yl group. These reactions enable the synthesis of biologically active compounds, natural products, and advanced materials with high efficiency and precision.In conclusion, Pent-4-en-1-yltriphenylphosphonium bromide is a valuable reagent in chemical synthesis, offering synthetic chemists a powerful tool for the construction of complex organic molecules through versatile reactions such as the Wittig reaction and cross-coupling reactions. Its unique reactivity and stability make it an essential component in the toolkit of organic chemists seeking to access diverse molecular architectures.