
Catalog Number	AR00EC0K
Chemical Name	21-Acetoxypregnenolone
CAS Number	566-78-9
Molecular Formula	C23H34O4
Molecular Weight	374.5137
MDL Number	MFCD00021130
SMILES	OC1CC[C@]2(C(=CC[C@@H]3[C@@H]2CC[C@]2([C@H]3CC[C@@H]2C(=O)COC(=O)C)C)C1)C

21-Acetoxypregnenolone, a powerful steroid compound, plays a crucial role in chemical synthesis as a key intermediate in the production of various pharmaceuticals. Its unique structure and reactivity make it a versatile building block in the synthesis of corticosteroids, sex hormones, and other bioactive molecules. By utilizing 21-Acetoxypregnenolone in chemical reactions, chemists can efficiently functionalize the steroid core to create diverse analogs with modified biological activities. Its importance lies in its ability to serve as a starting material for the preparation of potent drugs that target a wide range of medical conditions.