
Catalog Number	AR00EHL3
Chemical Name	Steppogenin
CAS Number	56486-94-3
Molecular Formula	C15H12O6
Molecular Weight	288.2522
MDL Number	MFCD20274687
SMILES	Oc1ccc(c(c1)O)[C@@H]1CC(=O)c2c(O1)cc(cc2O)O

Steppogenin, a naturally occurring compound found in certain plants, plays a crucial role in chemical synthesis as a versatile building block. With its unique structure and reactivity, Steppogenin is utilized in the creation of various pharmaceuticals, agrochemicals, and specialty chemicals. In chemical synthesis, Steppogenin serves as a key intermediate for the production of complex organic molecules through strategic functional group transformations and bond-forming reactions. Its ability to participate in diverse chemical reactions, such as cross-coupling, oxidation, and reduction processes, makes Steppogenin a valuable tool for synthesizing new compounds with potential applications in drug discovery, materials science, and other fields. Chemists leverage the versatility of Steppogenin to access novel molecular scaffolds and develop innovative synthetic routes, highlighting its significant impact on advancing the frontiers of chemical research and discovery.