
Catalog Number	AR00DFAS
Chemical Name	2-THIOPHEN-2-YL-INDOLE
CAS Number	55968-16-6
Molecular Formula	C12H9NS
Molecular Weight	199.2716
MDL Number	MFCD00661775
SMILES	c1csc(c1)c1cc2c([nH]1)cccc2

2-(Thiophen-2-yl)-1H-indole, also known as $name$, serves as a versatile building block in chemical synthesis due to its unique structural properties. This compound is commonly used as a key intermediate in the synthesis of various biologically active molecules and pharmaceuticals. Its thiophene ring provides aromaticity and electron density, allowing for efficient functionalization through various chemical reactions such as Friedel-Crafts acylation, Suzuki coupling, and Grignard reactions. Additionally, the presence of the indole moiety in the molecule imparts important pharmacological properties, making it a valuable scaffold in drug discovery and development. The combination of thiophene and indole in this compound offers synthetic chemists a powerful tool for the construction of diverse molecular architectures with potential applications in medicinal chemistry and material science.