
Catalog Number	AR00DZEK
Chemical Name	4-hydroxyderricin
CAS Number	55912-03-3
Molecular Formula	C21H22O4
Molecular Weight	338.3970
MDL Number	MFCD11040950
SMILES	COc1ccc(c(c1CC=C(C)C)O)C(=O)/C=C/c1ccc(cc1)O

4-Hydroxyderricin is a naturally occurring compound that has found valuable applications in chemical synthesis processes. This versatile compound serves as a key building block in the creation of various pharmaceuticals, agrochemicals, and fine chemicals. Its unique chemical structure makes it a crucial intermediate in the synthesis of biologically active molecules and complex organic compounds. By being able to undergo various chemical reactions, 4-Hydroxyderricin plays a significant role in the development of new materials and compounds with diverse functions and applications. Its versatility and reactivity make it a valuable tool for chemists and researchers in the field of chemical synthesis.