
Catalog Number	AR00DMEN
Chemical Name	1-(2-Hydroxy-5-nitrophenyl)propan-1-one
CAS Number	55805-95-3
Molecular Formula	C9H9NO4
Molecular Weight	195.1721
MDL Number	MFCD00218587
SMILES	CCC(=O)c1cc(ccc1O)[N+](=O)[O-]

1-(2-Hydroxy-5-nitrophenyl)propan-1-one, also known as $name$, serves as a versatile compound in chemical synthesis. Its unique structure, incorporating a hydroxy and nitro group, makes it a valuable building block in organic chemistry. This compound is particularly utilized in the creation of various pharmaceutical intermediates, agrochemicals, and organic dyes. In chemical synthesis, $name$ can function as a key precursor for the formation of complex molecules through diverse reactions such as acylation, condensation, and reduction. Its strategic placement of functional groups allows for selective modifications, enabling the synthesis of compounds with tailored properties and functionality. By incorporating 1-(2-Hydroxy-5-nitrophenyl)propan-1-one into synthetic pathways, chemists can obtain compounds with enhanced biological activities, improved stability, and desirable optical properties.