
Catalog Number	AR00DPD3
Chemical Name	1-(beta-carboxyethyl)-3,3-dimethyl-6'-nitrospiro(indoline- 2,2'-2H-benzopyran)
CAS Number	55779-26-5
Molecular Formula	C21H20N2O5
Molecular Weight	380.3939
MDL Number	MFCD28900767
SMILES	OC(=O)CCN1c2ccccc2C(C21C=Cc1c(O2)ccc(c1)[N+](=O)[O-])(C)C

Spiro[2H-1-benzopyran-2,2'-[2H]indole]-1'(3'H)-propanoic acid, 3',3'-dimethyl-6-nitro- is a versatile compound widely used in chemical synthesis. It serves as a key building block for the construction of complex organic molecules due to its unique spirocyclic structure. This compound exhibits notable reactivity in various synthetic transformations, making it valuable for the production of pharmaceuticals, agrochemicals, and functional materials. Its presence in a synthesis reaction can lead to the formation of heterocyclic compounds with enhanced biological activities and diverse physical properties.