
Catalog Number	AR00DKON
Chemical Name	oxoglaucine
CAS Number	5574-24-3
Molecular Formula	C20H17NO5
Molecular Weight	351.3527
MDL Number	MFCD07189861
SMILES	COc1cc2c(cc1OC)C(=O)c1c3c2c(OC)c(OC)cc3ccn1

1,2,9,10-Tetramethoxy-7H-dibenzo[de,g]quinolin-7-one is a highly versatile compound widely utilized in chemical synthesis due to its unique structural properties. This compound serves as a valuable building block in the creation of novel materials and pharmaceuticals. Its intricate molecular structure allows for precise manipulation and modification, making it an essential reagent in the development of complex organic compounds. In chemical synthesis, 1,2,9,10-Tetramethoxy-7H-dibenzo[de,g]quinolin-7-one acts as a key intermediate in various synthetic pathways, enabling the formation of diverse molecular architectures with tailored properties and functionalities. Its ability to undergo selective reactions and participate in intricate bond-forming processes makes it an indispensable tool for chemists working towards the synthesis of advanced materials and bioactive molecules.