
Catalog Number	AR00DCHA
Chemical Name	Methyl 2,3,5-tri-O-benzyl-beta-D-ribofuranoside
CAS Number	55725-85-4
Molecular Formula	C27H30O5
Molecular Weight	434.5241
MDL Number	MFCD04039623
SMILES	CO[C@@H]1O[C@@H]([C@H]([C@H]1OCc1ccccc1)OCc1ccccc1)COCc1ccccc1

The compound (2R,3R,4R,5R)-3,4-Bis(benzyloxy)-2-((benzyloxy)methyl)-5-methoxytetrahydrofuran serves as a versatile building block in chemical synthesis processes. With its unique structural arrangement, this compound exhibits reactivity that enables its incorporation in the construction of complex organic molecules. In synthetic chemistry, (2R,3R,4R,5R)-3,4-Bis(benzyloxy)-2-((benzyloxy)methyl)-5-methoxytetrahydrofuran acts as a key intermediate for the introduction of functional groups and structural motifs in target compounds. Its strategic placement within a synthetic pathway allows for the selective modification of specific sites, facilitating the preparation of various organic molecules with desired properties. By harnessing the reactivity of this compound, chemists can efficiently assemble intricate molecular structures and advance their research in the field of chemical synthesis.