
Catalog Number	AR003RO7
Chemical Name	hydroxytrimethylene)bis(trimethylammonium) dichloride (BISQUAT)
CAS Number	55636-09-4
Molecular Formula	C9H24Cl2N2O
Molecular Weight	247.2057
MDL Number	MFCD30145921
SMILES	OC(C[N+](C)(C)C)C[N+](C)(C)C.[Cl-].[Cl-]

1,3-Propanediaminium, 2-hydroxy-N1,N1,N1,N3,N3,N3-hexamethyl-, chloride (1:2) is a versatile compound that finds wide application in chemical synthesis. This compound is commonly used as a catalyst in organic reactions due to its unique structure and properties. In organic synthesis, it can act as a Lewis acid catalyst, promoting various transformations such as acylations, alkylations, and condensations. Its ability to activate substrates and facilitate the formation of new bonds makes it a valuable tool in the preparation of complex organic molecules. Additionally, the presence of the hydroxy group in the molecule allows for interactions with different functional groups, enhancing its reactivity and selectivity in a range of chemical reactions. Overall, 1,3-Propanediaminium, 2-hydroxy-N1,N1,N1,N3,N3,N3-hexamethyl-, chloride (1:2) plays a crucial role in advancing synthetic methodologies and enabling the efficient synthesis of diverse organic compounds.