
Catalog Number	AR003V1D
Chemical Name	Sulfuric acid, monopentyl ester, sodium salt
CAS Number	556-76-3
Molecular Formula	C5H11NaO4S
Molecular Weight	190.1932
MDL Number	MFCD00041882
SMILES	CCCCCOS(=O)(=O)[O-].[Na+]

Sodium pentyl sulfate, a versatile chemical compound, finds application in various chemical synthesis processes. Its unique properties make it a valuable reagent in organic chemistry, particularly in the synthesis of complex molecules and pharmaceutical intermediates. Sodium pentyl sulfate is often used as a surfactant or emulsifier in reactions involving water-insoluble compounds, helping to solubilize reactants and promote efficient mixing. Additionally, it can act as a catalyst in certain reactions, facilitating the conversion of starting materials into desired products. Its role in controlling reaction kinetics and enhancing product yield makes it a crucial component in the toolbox of synthetic chemists.