
Catalog Number	AR00DHOH
Chemical Name	Myriceric acid B
CAS Number	55497-79-5
Molecular Formula	C39H54O7
Molecular Weight	634.8419
MDL Number	MFCD20274875
SMILES	O=C(OC[C@@]12CC[C@@]3([C@H](C1=CC[C@H]1[C@@]2(C)CC[C@@H]2[C@]1(C)CC[C@@H](C2(C)C)O)CC(CC3)(C)C)C(=O)O)/C=C/c1ccc(c(c1)O)O

Myriceric acid B, a natural compound found in plants, is commonly utilized in chemical synthesis for its unique properties and versatile applications. This organic acid serves as a valuable building block in the creation of various chemical derivatives through esterification, amidation, and other transformative reactions. In the field of organic chemistry, Myriceric acid B is particularly prized for its ability to participate in diverse coupling reactions, allowing for the synthesis of complex molecules with enhanced functionalities. Whether employed as a key precursor in the production of pharmaceutical intermediates or as a catalyst in organic transformations, Myriceric acid B plays a crucial role in advancing the frontiers of chemical synthesis.